cas: 1260609-97-9 — see every product listed under this CAS number, including other names
(S)-6-Fluorochroman-4-amine hydrochloride, 95%, 95% (CAS 1260609-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QWD-100mg |
| cas | 1260609-97-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 2171.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1260609-97-9) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: (4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VHMBQKMHABXVJN-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | (4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VHMBQKMHABXVJN-QRPNPIFTSA-N |
| SMILES | C1COC2=C([C@H]1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)