CAS 191609-45-7 appears in our catalog under these names: 6-Fluoro-chroman-4-ylamine hydrochloride, 95%, 6-Fluorochroman-4-amine hydrochloride 95%, 2H-1-Benzopyran-4-amine, 6-fluoro-3,4-dihydro-, hydrochloride (1:1), 95%, 95%, 6-Fluorochroman-4-amine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 191609-45-7) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VHMBQKMHABXVJN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VHMBQKMHABXVJN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)