CAS 911826-09-0 appears in our catalog under these names: (R)-6-Fluorochroman-4-amine hydrochloride, 95%, (R)–4–Amino–6–fluorochromane Hydrochloride, (R)-4-Amino-6-fluorochromane Hydrochloride 95%, (R)-6-Fluorochroman-4-amine hydrochloride, 95%, 95%, (R)-6-Fluorochroman-4-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
(4R)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 911826-09-0) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: (4R)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VHMBQKMHABXVJN-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | (4R)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VHMBQKMHABXVJN-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)