cas: 193693-69-5 — see every product listed under this CAS number, including other names
(S)-Benzyl 3-cyanopyrrolidine-1-carboxylate, 98+% (CAS 193693-69-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A815193-10g |
| cas | 193693-69-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6332.62 Pln | |
| AmBeed | 5g | 4242.91 Pln | |
| AmBeed | 25g | 7647.64 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (3S)-3-cyanopyrrolidine-1-carboxylate (CAS 193693-69-5) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: benzyl (3S)-3-cyanopyrrolidine-1-carboxylate. InChIKey: WNULFIVJZGZMEY-GFCCVEGCSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzyl (3S)-3-cyanopyrrolidine-1-carboxylate |
| InChIKey | WNULFIVJZGZMEY-GFCCVEGCSA-N |
| SMILES | C1CN(C[C@H]1C#N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)