cas: 13512-57-7 — see every product listed under this CAS number, including other names
(S)-Benzyl 4-Amino-2-((Tert-Butoxycarbonyl)Amino)-4-Oxobutanoate, 97%, 97% (CAS 13512-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C4D-100mg |
| cas | 13512-57-7 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 539.60 Pln | |
| Chemat | 25g | 1245.20 Pln | |
| Chemat | 50g | 2358.80 Pln | |
| Chemat | 100g | 4173.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 13512-57-7) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: VNFPRPGXGYMAKL-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | VNFPRPGXGYMAKL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)