cas: 189619-55-4 — see every product listed under this CAS number, including other names
(S)-Boc-β2-HoPhe-OH 95% (CAS 189619-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109013-100mg |
| cas | 189619-55-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 887.69 Pln | |
| Ambeed | 1g | 2105.88 Pln | |
| Ambeed | 5g | 8219.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A109013 |
(2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 189619-55-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZYCITKXROAFBAR-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZYCITKXROAFBAR-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)