cas: 13726-52-8 — see every product listed under this CAS number, including other names
(S)-Diethyl 2-(4-aminobenzamido)pentanedioate, 97%, 97% (CAS 13726-52-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11242I-1g |
| cas | 13726-52-8 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1384.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate (CAS 13726-52-8) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate. InChIKey: RJXFBLRRPYBPTM-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate |
| InChIKey | RJXFBLRRPYBPTM-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)