cas: 13726-52-8 — see every product listed under this CAS number, including other names
N-4-Abz-Glu(OEt)-OEt 97% (CAS 13726-52-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A793856-1g |
| cas | 13726-52-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 1060.12 Pln | |
| Ambeed | 25g | 3001.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A793856 |
Diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate (CAS 13726-52-8) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate. InChIKey: RJXFBLRRPYBPTM-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate |
| InChIKey | RJXFBLRRPYBPTM-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)