cas: 141636-66-0 — see every product listed under this CAS number, including other names
(S)-Fmoc-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid, ≥98%, ≥98% (CAS 141636-66-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GRB-250mg |
| cas | 141636-66-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 1547.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 141636-66-0) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: AHWBFHCBDIMJQV-SFHVURJKSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | AHWBFHCBDIMJQV-SFHVURJKSA-N |
| SMILES | CC1([C@@H](N(CS1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)C |
Computed by PubChem (NCBI)