CAS 873842-06-9 appears in our catalog under these names: Fmoc-l-thz(me2)-oh, 98%, Fmoc-L-Thz(Me2)-OH, (R)-3-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2,2-dimethylthiazolidine-4-carboxylic Acid, >97.0%(HPLC), Fmoc-L-Thz(Me2)-OH 98%, Fmoc-L-Thz(Me2)-OH, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g, 100g, 10g.
(4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 873842-06-9) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: UPFXVBZXMLAMDX-SFHVURJKSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | UPFXVBZXMLAMDX-SFHVURJKSA-N |
| SMILES | CC1(N([C@@H](CS1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)