CAS 1932198-36-1 is the registry number for Fmoc-(4-s)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 1932198-36-1) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: UPFXVBZXMLAMDX-GOSISDBHSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | UPFXVBZXMLAMDX-GOSISDBHSA-N |
| SMILES | CC1(N([C@H](CS1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)