CAS 368866-35-7 appears in our catalog under these names: 4-(9H-Fluoren-9-ylmethoxycarbonylamino)-tetrahydro-thiopyran-4-carboxylic acid, 95%, 4–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)tetrahydro–2H–thiopyran–4–carboxylic acid, Fmoc-ThtpGly-OH, Fmoc-ThtpGly-OH 95%, 2H-Thiopyran-4-carboxylic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
4-(9H-fluoren-9-ylmethoxycarbonylamino)thiane-4-carboxylic acid (CAS 368866-35-7) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)thiane-4-carboxylic acid. InChIKey: KEJAASWNXTXYMD-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)thiane-4-carboxylic acid |
| InChIKey | KEJAASWNXTXYMD-UHFFFAOYSA-N |
| SMILES | C1CSCCC1(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)