Products 1881295-41-5
CAS 1881295-41-5 is the registry number for N-benzyl-4-hydroxy-N-[(4-methoxyphenyl)methyl]benzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-benzyl-4-hydroxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 1881295-41-5) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: N-benzyl-4-hydroxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: BCLFXRUYHPYQBZ-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | N-benzyl-4-hydroxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | BCLFXRUYHPYQBZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(CC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)