cas: 176504-88-4 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)-3,3-dimethylbutanoate, 97%, 97% (CAS 176504-88-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BACT-10g |
| cas | 176504-88-4 |
| size | 10g |
| availability | 115g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 232.40 Pln | |
| Chemat | 50g | 890.00 Pln | |
| Chemat | 100g | 1648.40 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 176504-88-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: NDACBWZNPPVOJB-MRVPVSSYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | NDACBWZNPPVOJB-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)