cas: 176504-88-4 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)-3,3-dimethylbutanoate, 97% (CAS 176504-88-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F516474-5G |
| cas | 176504-88-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 25g | 763.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 176504-88-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: NDACBWZNPPVOJB-MRVPVSSYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | NDACBWZNPPVOJB-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)