cas: 89985-87-5 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)pent-4-enoate, 95%, 95% (CAS 89985-87-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143HD-50mg |
| cas | 89985-87-5 |
| size | 50mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1360.40 Pln | |
| Chemat | 25g | 4797.20 Pln | |
| Chemat | 100g | 12659.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (CAS 89985-87-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate. InChIKey: APXWRHACXBILLH-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| InChIKey | APXWRHACXBILLH-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)C(=O)OC |
Computed by PubChem (NCBI)