cas: 89985-87-5 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)pent-4-enoate, 95% (CAS 89985-87-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601947-100MG |
| cas | 89985-87-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1747.32 Pln | |
| Fluorochem | 10g | 3439.43 Pln | |
| Fluorochem | 25g | 7953.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (CAS 89985-87-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate. InChIKey: APXWRHACXBILLH-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| InChIKey | APXWRHACXBILLH-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)C(=O)OC |
Computed by PubChem (NCBI)