cas: 7625-57-2 — see every product listed under this CAS number, including other names
(S)-Methyl 2-(2-((tert-butoxycarbonyl)amino)-3-phenylpropanamido)acetate, 98% (CAS 7625-57-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463139-1G |
| cas | 7625-57-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 518.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate (CAS 7625-57-2) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate. InChIKey: KRYDBLGWCUNDCJ-ZDUSSCGKSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate |
| InChIKey | KRYDBLGWCUNDCJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NCC(=O)OC |
Computed by PubChem (NCBI)