cas: 1391571-15-5 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-3-(2,4-dimethylphenyl)propanoate hydrochloride, 95%, 95% (CAS 1391571-15-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDOO-250mg |
| cas | 1391571-15-5 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 846.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride (CAS 1391571-15-5) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride. InChIKey: CRGIWBPGJAHRNL-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride |
| InChIKey | CRGIWBPGJAHRNL-MERQFXBCSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)