CAS 2964-09-2 appears in our catalog under these names: Benzoylcholine chloride, 98%, Benzoylcholine Chloride, >98.0%(T), Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride (1:1), 98%, 98%, Benzoylcholine (chloride), 98.89%. Offered by: Combi-blocks, TCI, Chemat, MedChemExpress. Available pack sizes: 25g, 1g, 5g, 250mg, 25 g, 10 g, 5 g.
2-benzoyloxyethyl(trimethyl)azanium chloride (CAS 2964-09-2) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 2-benzoyloxyethyl(trimethyl)azanium chloride. InChIKey: QVFHQENRNSAHEK-UHFFFAOYSA-M.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 2-benzoyloxyethyl(trimethyl)azanium chloride |
| InChIKey | QVFHQENRNSAHEK-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCOC(=O)C1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)