(S)-Methyl 2-amino-3-cyclobutylpropanoate hydrochloride, 95%
cas: 2323072-00-8 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-3-cyclobutylpropanoate hydrochloride, 95% (CAS 2323072-00-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A668307-250mg |
| cas | 2323072-00-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1710.94 Pln | |
| Ambeed | 5g | 6644.88 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1773.20 Pln | |
| Chemat | 5g | 6899.60 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 753.09 Pln | |
| BLDpharm | 1g | 1847.15 Pln | |
| BLDpharm | 5g | 7178.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride (CAS 2323072-00-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride. InChIKey: OIIWGMFNFPCAEB-FJXQXJEOSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride |
| InChIKey | OIIWGMFNFPCAEB-FJXQXJEOSA-N |
| SMILES | COC(=O)[C@H](CC1CCC1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 2-amino-3-cyclobutylpropanoate hydrochloride, (S)-Methyl 2-amino-3-cyclobutylpropanoate HCl, (S)-Methyl2-amino-3-cyclobutylpropanoatehydrochloride, methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride, methyl (S)-2-amino-3-cyclobutylpropanoate hydrochloride, methyl (2S)-2-amino-3-cyclobutyl-propanoate;hydrochloride