CAS 2323072-00-8 appears in our catalog under these names: (S)-Methyl 2-amino-3-cyclobutylpropanoate hydrochloride, 95%, 95%, (S)-Methyl 2-amino-3-cyclobutylpropanoate hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride (CAS 2323072-00-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride. InChIKey: OIIWGMFNFPCAEB-FJXQXJEOSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-cyclobutylpropanoate;hydrochloride |
| InChIKey | OIIWGMFNFPCAEB-FJXQXJEOSA-N |
| SMILES | COC(=O)[C@H](CC1CCC1)N.Cl |
Computed by PubChem (NCBI)