Products 1520072-58-5

CAS 1520072-58-5 is the registry number for Methyl 2-amino-3-cyclobutylpropanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-cyclobutylpropanoate;hydrochloride (CAS 1520072-58-5) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl 2-amino-3-cyclobutylpropanoate;hydrochloride. InChIKey: OIIWGMFNFPCAEB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC namemethyl 2-amino-3-cyclobutylpropanoate;hydrochloride
InChIKeyOIIWGMFNFPCAEB-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1CCC1)N.Cl

Computed by PubChem (NCBI)