cas: 1391447-69-0 — see every product listed under this CAS number, including other names
(S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride 97% (CAS 1391447-69-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A251671-50mg |
| cas | 1391447-69-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 592.88 Pln | |
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1249.25 Pln | |
| Ambeed | 1g | 3134.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A251671 |
Methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1391447-69-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: SWIJKZSHJUALNL-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | SWIJKZSHJUALNL-SBSPUUFOSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)