CAS 879278-55-4 appears in our catalog under these names: Benzyl 2-amino-3-hydroxypropanoate hydrochloride, 98%, Benzyl 2-amino-3-hydroxypropanoate hydrochloride, 95%, DL–Ser–Obzl·Hcl, Benzyl 2-amino-3-hydroxypropanoate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g.
Benzyl 2-amino-3-hydroxypropanoate;hydrochloride (CAS 879278-55-4) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: benzyl 2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: MGZWCDQAKCHOBX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | benzyl 2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | MGZWCDQAKCHOBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CO)N.Cl |
Computed by PubChem (NCBI)