CAS 1391447-69-0 appears in our catalog under these names: (S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%, (S)–Methyl 3–(1–amino–2–hydroxyethyl)benzoate hydrochloride, (S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride 97%, (S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97%, 97%, (S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
Methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1391447-69-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: SWIJKZSHJUALNL-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | SWIJKZSHJUALNL-SBSPUUFOSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)