cas: 1391447-69-0 — see every product listed under this CAS number, including other names
(S)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97% (CAS 1391447-69-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517471-50MG |
| cas | 1391447-69-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1299.56 Pln | |
| Fluorochem | 100mg | 1794.18 Pln | |
| Fluorochem | 250mg | 3512.32 Pln | |
| Fluorochem | 1g | 9260.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1391447-69-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: SWIJKZSHJUALNL-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | SWIJKZSHJUALNL-SBSPUUFOSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)