Products 1654774-00-1

CAS 1654774-00-1 is the registry number for H-DL-Tyr(Me)-OH hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride (CAS 1654774-00-1) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: OWJANEXICRZDJT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC name2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride
InChIKeyOWJANEXICRZDJT-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)