cas: 37088-66-7 — see every product listed under this CAS number, including other names
(S)-Methyl 3-amino-3-phenylpropanoate 98% (CAS 37088-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158960-100g |
| cas | 37088-66-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 7245.62 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 681.88 Pln | |
| Ambeed | 25g | 2311.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158960 |
Methyl (3S)-3-amino-3-phenylpropanoate (CAS 37088-66-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl (3S)-3-amino-3-phenylpropanoate. InChIKey: XKIOBYHZFPTKCZ-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-phenylpropanoate |
| InChIKey | XKIOBYHZFPTKCZ-VIFPVBQESA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)