cas: 37088-66-7 — see every product listed under this CAS number, including other names
(S)-Methyl 3-amino-3-phenylpropanoate, 97%, 97% (CAS 37088-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8Z9-100mg |
| cas | 37088-66-7 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 25g | 1379.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (3S)-3-amino-3-phenylpropanoate (CAS 37088-66-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl (3S)-3-amino-3-phenylpropanoate. InChIKey: XKIOBYHZFPTKCZ-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-phenylpropanoate |
| InChIKey | XKIOBYHZFPTKCZ-VIFPVBQESA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)