cas: 126587-35-7 — see every product listed under this CAS number, including other names
(S)-Methyl 4-((tert-butoxycarbonyl)amino)-5-hydroxypentanoate, >95%, >95% (CAS 126587-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SYM-100mg |
| cas | 126587-35-7 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1269.20 Pln | |
| Chemat | 5g | 2579.60 Pln | |
| Chemat | 10g | 4370.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl (4S)-5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 126587-35-7) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: methyl (4S)-5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: SRVJJSKMYILGAM-QMMMGPOBSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | methyl (4S)-5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | SRVJJSKMYILGAM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)CO |
Computed by PubChem (NCBI)