CAS 136092-75-6 appears in our catalog under these names: N-(tert-Butoxycarbonyl)-n,o-dimethyl-l-threonine, 95%, (2S,3R)–2–((tert–butoxycarbonyl)(methyl)amino)–3–methoxybutanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S,3R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 136092-75-6) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2S,3R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: GPOFBERDSRBKHN-SFYZADRCSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2S,3R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | GPOFBERDSRBKHN-SFYZADRCSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)