CAS 1318775-45-9 is the registry number for (2R,3S)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-methylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(2R,3S)-2-hydroxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1318775-45-9) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2R,3S)-2-hydroxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: COFHICKJCPSJGE-JGVFFNPUSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2R,3S)-2-hydroxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | COFHICKJCPSJGE-JGVFFNPUSA-N |
| SMILES | CC(C)[C@@H]([C@H](C(=O)O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)