Products 1417034-23-1

CAS 1417034-23-1 is the registry number for tert-Butyl 2-({[(tert-butoxy)carbonyl]amino}oxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetate (CAS 1417034-23-1) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetate. InChIKey: WFCUBYDJWBMIDO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO5
Molecular weight247.29 g/mol
IUPAC nametert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetate
InChIKeyWFCUBYDJWBMIDO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CONC(=O)OC(C)(C)C

Computed by PubChem (NCBI)