CAS 1233513-26-2 appears in our catalog under these names: Boc-homo-beta-2-Hydoxyvaline, 2-(Boc-aminomethyl)-3-hydroxy-3-methylbutanoic acid, 95%, 2-(((tert-Butoxycarbonyl)amino)methyl)-3-hydroxy-3-methylbutanoic acid, 97%. Offered by: Iris Biotech, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-hydroxy-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid (CAS 1233513-26-2) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: 3-hydroxy-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid. InChIKey: UUCSJBBACWWTCF-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 3-hydroxy-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
| InChIKey | UUCSJBBACWWTCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C(=O)O)C(C)(C)O |
Computed by PubChem (NCBI)