cas: 1351395-66-8 — see every product listed under this CAS number, including other names
(S)-N-(1-HYDROXYPROPAN-2-YL)-2-NITROBENZENESULFONAMIDE, 95%, 95% (CAS 1351395-66-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110E53-10g |
| cas | 1351395-66-8 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1648.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 894.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide (CAS 1351395-66-8) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide. InChIKey: FDFFWQKRBIFMNE-ZETCQYMHSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide |
| InChIKey | FDFFWQKRBIFMNE-ZETCQYMHSA-N |
| SMILES | C[C@@H](CO)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)