CAS 321705-93-5 appears in our catalog under these names: N-(2-Methoxyethyl)-4-nitrobenzenesulfonamide, 95%, N–(2–methoxyethyl)–4–nitrobenzenesulfonamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
N-(2-methoxyethyl)-4-nitrobenzenesulfonamide (CAS 321705-93-5) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: N-(2-methoxyethyl)-4-nitrobenzenesulfonamide. InChIKey: FBAFPGCLWAAVDY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | N-(2-methoxyethyl)-4-nitrobenzenesulfonamide |
| InChIKey | FBAFPGCLWAAVDY-UHFFFAOYSA-N |
| SMILES | COCCNS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)