Products 99363-02-7
CAS 99363-02-7 is the registry number for 4-Methoxy-N,N-dimethyl-3-nitrobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-methoxy-N,N-dimethyl-3-nitrobenzenesulfonamide (CAS 99363-02-7) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: 4-methoxy-N,N-dimethyl-3-nitrobenzenesulfonamide. InChIKey: FTUMQRKEMKZWOH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 4-methoxy-N,N-dimethyl-3-nitrobenzenesulfonamide |
| InChIKey | FTUMQRKEMKZWOH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)