cas: 1351395-66-8 — see every product listed under this CAS number, including other names
N-[(1S)-2-Hydroxy-1-methylethyl]-2-nitrobenzenesulfonamide 95% (CAS 1351395-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111764-100mg |
| cas | 1351395-66-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 759.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A111764 |
N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide (CAS 1351395-66-8) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide. InChIKey: FDFFWQKRBIFMNE-ZETCQYMHSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | N-[(2S)-1-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide |
| InChIKey | FDFFWQKRBIFMNE-ZETCQYMHSA-N |
| SMILES | C[C@@H](CO)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)