Products 1323733-50-1
CAS 1323733-50-1 is the registry number for 2-Methoxy-N,N-dimethyl-5-nitrobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-N,N-dimethyl-5-nitrobenzenesulfonamide (CAS 1323733-50-1) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: 2-methoxy-N,N-dimethyl-5-nitrobenzenesulfonamide. InChIKey: DWHVEQLUHJWBQI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 2-methoxy-N,N-dimethyl-5-nitrobenzenesulfonamide |
| InChIKey | DWHVEQLUHJWBQI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)