cas: 158663-69-5 — see every product listed under this CAS number, including other names
(S)-Piperazine-2-carboxylic acid dihydrochloride, 95%, 95% (CAS 158663-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QQW-250mg |
| cas | 158663-69-5 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 100g | 952.40 Pln | |
| Chemat | 50g | 506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-piperazine-2-carboxylic acid;dihydrochloride (CAS 158663-69-5) is a chemical compound with the molecular formula C5H12Cl2N2O2 and a molecular weight of 203.06 g/mol. IUPAC name: (2S)-piperazine-2-carboxylic acid;dihydrochloride. InChIKey: WNSDZBQLMGKPQS-FHNDMYTFSA-N.
| Molecular formula | C5H12Cl2N2O2 |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | (2S)-piperazine-2-carboxylic acid;dihydrochloride |
| InChIKey | WNSDZBQLMGKPQS-FHNDMYTFSA-N |
| SMILES | C1CN[C@@H](CN1)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)