CAS 126330-90-3 appears in our catalog under these names: (R)-Piperazine-2-carboxylic acid dihydrochloride 98%, (R)-Piperazine-2-carboxylic acid dihydrochloride, 98%, 98%, (R)-(+)-Piperazine-2-carboxylic acid dihydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g.
(2R)-piperazine-2-carboxylic acid;dihydrochloride (CAS 126330-90-3) is a chemical compound with the molecular formula C5H12Cl2N2O2 and a molecular weight of 203.06 g/mol. IUPAC name: (2R)-piperazine-2-carboxylic acid;dihydrochloride. InChIKey: WNSDZBQLMGKPQS-RZFWHQLPSA-N.
| Molecular formula | C5H12Cl2N2O2 |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | (2R)-piperazine-2-carboxylic acid;dihydrochloride |
| InChIKey | WNSDZBQLMGKPQS-RZFWHQLPSA-N |
| SMILES | C1CN[C@H](CN1)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)