CAS 158663-69-5 appears in our catalog under these names: (S)–(–)–Piperazine–2–carboxylic acid dihydrochloride, (S)-(-)-Piperazine-2-carboxylic acid dihydrochloride, 98+% , (S)-Piperazine-2-carboxylic acid dihydrochloride 95%, (S)-Piperazine-2-carboxylic acid dihydrochloride, 95%, 95%, (S)-piperazine-2-carboxylic acid dihydrochloride, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 50g.
(2S)-piperazine-2-carboxylic acid;dihydrochloride (CAS 158663-69-5) is a chemical compound with the molecular formula C5H12Cl2N2O2 and a molecular weight of 203.06 g/mol. IUPAC name: (2S)-piperazine-2-carboxylic acid;dihydrochloride. InChIKey: WNSDZBQLMGKPQS-FHNDMYTFSA-N.
| Molecular formula | C5H12Cl2N2O2 |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | (2S)-piperazine-2-carboxylic acid;dihydrochloride |
| InChIKey | WNSDZBQLMGKPQS-FHNDMYTFSA-N |
| SMILES | C1CN[C@@H](CN1)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)