Products 71160-05-9

CAS 71160-05-9 is the registry number for Dimethyl Malonimidate Dihydrochloride. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Dimethyl propanediimidate;dihydrochloride (CAS 71160-05-9) is a chemical compound with the molecular formula C5H12Cl2N2O2 and a molecular weight of 203.06 g/mol. IUPAC name: dimethyl propanediimidate;dihydrochloride. InChIKey: ZYBFEKQCCYBQLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H12Cl2N2O2
Molecular weight203.06 g/mol
IUPAC namedimethyl propanediimidate;dihydrochloride
InChIKeyZYBFEKQCCYBQLZ-UHFFFAOYSA-N
SMILESCOC(=N)CC(=N)OC.Cl.Cl

Computed by PubChem (NCBI)