cas: 53174-06-4 — see every product listed under this CAS number, including other names
(S)-Trolox, 99.38% (CAS 53174-06-4) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-101445B-10mM/1mL |
| cas | 53174-06-4 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 328.98 Pln | |
| MedChemExpress | 100 mg | 407.93 Pln | |
| MedChemExpress | 50 mg | 310.40 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.38% |
(2S)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (CAS 53174-06-4) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (2S)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid. InChIKey: GLEVLJDDWXEYCO-AWEZNQCLSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| InChIKey | GLEVLJDDWXEYCO-AWEZNQCLSA-N |
| SMILES | CC1=C(C2=C(CC[C@@](O2)(C)C(=O)O)C(=C1O)C)C |
Computed by PubChem (NCBI)