cas: 1007882-58-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate, 98% (CAS 1007882-58-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225608-250MG |
| cas | 1007882-58-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 1799.38 Pln | |
| Fluorochem | 10g | 3121.84 Pln | |
| Fluorochem | 25g | 6188.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate (CAS 1007882-58-7) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate. InChIKey: GHITWFDHFOLATC-VIFPVBQESA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | GHITWFDHFOLATC-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C2=NC=CN2 |
Computed by PubChem (NCBI)