Products 75328-29-9

CAS 75328-29-9 is the registry number for 4-(2-Morpholinoethoxy)benzene-1,2-diamine trihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(2-morpholin-4-ylethoxy)benzene-1,2-diamine (CAS 75328-29-9) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: 4-(2-morpholin-4-ylethoxy)benzene-1,2-diamine. InChIKey: IFIRYWCUGOTOFV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19N3O2
Molecular weight237.30 g/mol
IUPAC name4-(2-morpholin-4-ylethoxy)benzene-1,2-diamine
InChIKeyIFIRYWCUGOTOFV-UHFFFAOYSA-N
SMILESC1COCCN1CCOC2=CC(=C(C=C2)N)N

Computed by PubChem (NCBI)