Products 21253-62-3

CAS 21253-62-3 is the registry number for 5-Amino-1-cyclohexyl-1h-pyrazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 5-amino-1-cyclohexylpyrazole-4-carboxylate (CAS 21253-62-3) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: ethyl 5-amino-1-cyclohexylpyrazole-4-carboxylate. InChIKey: NQLJJSMRVILYQD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19N3O2
Molecular weight237.30 g/mol
IUPAC nameethyl 5-amino-1-cyclohexylpyrazole-4-carboxylate
InChIKeyNQLJJSMRVILYQD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(N=C1)C2CCCCC2)N

Computed by PubChem (NCBI)