Products 1820603-79-9
CAS 1820603-79-9 appears in our catalog under these names: N-(2-Butylaminoethyl)-4-nitroaniline, 97%, N1-Butyl-N2-(4-nitrophenyl)ethane-1,2-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
N-butyl-N'-(4-nitrophenyl)ethane-1,2-diamine (CAS 1820603-79-9) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: N-butyl-N'-(4-nitrophenyl)ethane-1,2-diamine. InChIKey: QKOWUHLRFYQLLJ-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | N-butyl-N'-(4-nitrophenyl)ethane-1,2-diamine |
| InChIKey | QKOWUHLRFYQLLJ-UHFFFAOYSA-N |
| SMILES | CCCCNCCNC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)