Products 1332326-40-5
CAS 1332326-40-5 is the registry number for (R)-tert-Butyl 2-(1h-imidazol-2-yl)pyrrolidine-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
Tert-butyl (2R)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate (CAS 1332326-40-5) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl (2R)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate. InChIKey: GHITWFDHFOLATC-SECBINFHSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl (2R)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | GHITWFDHFOLATC-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C2=NC=CN2 |
Computed by PubChem (NCBI)